| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3,5,6-trichloro-2-pyridyloxyacetic acid |
| CAS: | [(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid |
| Reg. No.: | 55335-06-3 |
| Formula: | C7H4Cl3NO3 |
| Activity: | herbicides (pyridine herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example triclopyr-butotyl [64700-56-7], triclopyr-ethyl [60825-27-6], triclopyr-triethylammonium [57213-69-1]. |
| Structure: | ![]() |
| Pronunciation: | trī-klō-pīr Guide to British pronunciation |
| InChI: | InChI=1/C7H4Cl3NO3/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13/h1H,2H2,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names