| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 3,5,6-trichloro-2-pyridyloxyacetic acid - triethylamine (1:1) or triethylammonium 3,5,6-trichloro-2-pyridyloxyacetate |
| CAS: | [(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid compound with N,N-diethylethanamine (1:1) |
| Reg. No.: | 57213-69-1 |
| Formula: | C13H19Cl3N2O3 |
| Activity: | herbicides (pyridine herbicides) |
| Notes: | This substance is a derivative of triclopyr [55335-06-3]. |
| Structure: | ![]() |
| Pronunciation: | trī-klō-pīr trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C7H4Cl3NO3.C6H15N/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-4-7(5-2)6-3/h1H,2H2,(H,12,13);4-6H2,1-3H3/f/h12H; |
A data sheet from the Compendium of Pesticide Common Names