Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | [(3,5,6-trichloropyridin-2-yl)oxy]acetic acid—N,N-diethylethan-1-amine (1/1) |
IUPAC name: | [(3,5,6-trichloro-2-pyridyl)oxy]acetic acid - triethylamine (1:1) or triethylammonium [(3,5,6-trichloro-2-pyridyl)oxy]acetate |
CAS name: | 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid compound with N,N-diethylethanamine (1:1) |
CAS Reg. No.: | 57213-69-1 |
Formula: | C13H19Cl3N2O3 |
Activity: | herbicides (pyridyloxycarboxylic acid) |
Notes: | This substance is a derivative of triclopyr [55335-06-3]. |
Structure: | |
Pronunciation: | trī-klō-pīr trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | ROKVVMOXSZIDEG-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H4Cl3NO3.C6H15N/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-4-7(5-2)6-3/h1H,2H2,(H,12,13);4-6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names