Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-butoxyethyl [(3,5,6-trichloropyridin-2-yl)oxy]acetate |
IUPAC name: | 2-butoxyethyl [(3,5,6-trichloro-2-pyridyl)oxy]acetate |
CAS name: | 2-butoxyethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
CAS Reg. No.: | 64700-56-7 |
Formula: | C13H16Cl3NO4 |
Activity: | herbicides (pyridyloxycarboxylic acid) |
Notes: | This substance is a derivative of triclopyr [55335-06-3]. |
Structure: | |
Pronunciation: | trī-klō-pīr bū-tō-tīl Guide to British pronunciation |
InChIKey: | IVDRCZNHVGQBHZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H16Cl3NO4/c1-2-3-4-19-5-6-20-11(18)8-21-13-10(15)7-9(14)12(16)17-13/h7H,2-6,8H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names