Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-hydroxy-N,N,N-trimethylethan-1-aminium [(3,5,6-trichloropyridin-2-yl)oxy]acetate |
IUPAC name: | (2-hydroxyethyl)trimethylammonium [(3,5,6-trichloro-2-pyridyl)oxy]acetate |
CAS name: | 2-hydroxy-N,N,N-trimethylethanaminium 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
CAS Reg. No.: | 1048373-85-8 |
Formula: | C12H17Cl3N2O4 |
Activity: | herbicides (pyridyloxycarboxylic acid) |
Notes: | This substance is a derivative of triclopyr [55335-06-3]. |
Structure: | |
Pronunciation: | trī-klō-pīr kō-lēn Guide to British pronunciation |
InChIKey: | CCRUKTGQASMHHB-UHFFFAOYSA-M |
InChI: | InChI=1S/C7H4Cl3NO3.C5H14NO/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-6(2,3)4-5-7/h1H,2H2,(H,12,13);7H,4-5H2,1-3H3/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names