| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-(4-chloro-o-tolyloxy)butyric acid |
| CAS: | 4-(4-chloro-2-methylphenoxy)butanoic acid |
| Reg. No.: | 94-81-5 |
| Formula: | C11H13ClO3 |
| Activity: | herbicides (phenoxybutyric herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example MCPB-ethyl [10443-70-6], MCPB-methyl [57153-18-1], MCPB-sodium [6062-26-6]. The name “2,4-MCPB” is used in France. |
| Structure: | ![]() |
| InChI: | InChI=1/C11H13ClO3/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14)/f/h13H |
A data sheet from the Compendium of Pesticide Common Names