| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 4-(4-chloro-o-tolyloxy)butyrate |
| CAS: | sodium 4-(4-chloro-2-methylphenoxy)butanoate |
| Reg. No.: | 6062-26-6 |
| Formula: | C11H12ClNaO3 |
| Activity: | herbicides (phenoxybutyric herbicides) |
| Notes: | This substance is a derivative of MCPB [94-81-5]. The name “2,4-MCPB-sodium” is used in France. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē bē sō-dē-am Guide to British pronunciation |
| InChIKey: | GABUSZPTCJGKGB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C11H13ClO3.Na/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14;/h4-5,7H,2-3,6H2,1H3,(H,13,14);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names