| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl 4-(4-chloro-o-tolyloxy)butyrate |
| CAS: | methyl 4-(4-chloro-2-methylphenoxy)butanoate |
| Reg. No.: | 57153-18-1 |
| Formula: | C12H15ClO3 |
| Activity: | herbicides (phenoxybutyric herbicides) |
| Notes: | This substance is a derivative of MCPB [94-81-5]. The name “2,4-MCPB-methyl” is used in France. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē bē mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C12H15ClO3/c1-9-8-10(13)5-6-11(9)16-7-3-4-12(14)15-2/h5-6,8H,3-4,7H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names