| Status: | ISO 765 |
|---|---|
| IUPAC: | 6-hydroxy-2H-pyridazin-3-one
or 1,2-dihydropyridazine-3,6-dione |
| CAS: | 1,2-dihydro-3,6-pyridazinedione |
| Reg. No.: | 123-33-1 |
| Formula: | C4H4N2O2 |
| Activity: | plant growth regulators (growth inhibitors) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “maleic hydrazide” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | ma-lē-ǐk hī-dra-zīd Guide to British pronunciation |
| InChI: | InChI=1/C4H4N2O2/c7-3-1-2-4(8)6-5-3/h1-2H,(H,5,7)(H,6,8)/f/h5-6H |