Status: | modified ISO 765 (published) |
---|---|
IUPAC PIN: | potassium 6-oxo-1,6-dihydropyridazin-3-olate |
IUPAC name: | potassium 6-oxo-1,6-dihydropyridazin-3-olate |
CAS name: | 1,2-dihydro-3,6-pyridazinedione potassium salt (1:1) |
CAS Reg. No.: | 28382-15-2 |
Formula: | C4H3KN2O2 |
Activity: | plant growth regulators (gametocides; growth inhibitors) |
Notes: | This substance is a derivative of maleic hydrazide [123-33-1]. |
Structure: | |
Pronunciation: | ma-lē-ǐk hī-dra-zīd pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | ONFPEXMNTHPYGN-UHFFFAOYSA-M |
InChI: | InChI=1S/C4H4N2O2.K/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names