Status: | modified ISO 765 (published) |
---|---|
IUPAC PIN: | sodium 6-oxo-1,6-dihydropyridazin-3-olate |
IUPAC name: | potassium 6-oxo-1,6-dihydropyridazin-3-olate |
CAS name: | 1,2-dihydro-3,6-pyridazinedione sodium salt (1:1) |
CAS Reg. No.: | 28330-26-9 |
Formula: | C4H3N2NaO2 |
Activity: | plant growth regulators (gametocide; growth inhibitor) |
Notes: | This substance is a derivative of maleic hydrazide [123-33-1]. |
Structure: | |
Pronunciation: | ma-lē-ǐk hī-dra-zīd sō-dē-am Guide to British pronunciation |
InChIKey: | TZWQQLVMMAZOTJ-UHFFFAOYSA-M |
InChI: | InChI=1S/C4H4N2O2.Na/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names