Status: | ISO 1750 (published) |
---|---|
IUPAC name: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alanine |
CAS name: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alanine |
CAS Reg. No.: | 90134-59-1 |
Formula: | C16H13ClFNO3 |
Activity: | herbicides (arylaminopropionic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example flamprop-M-isopropyl [63782-90-1], flamprop-M-methyl [63729-98-6]. The unresolved enantiomeric mixture of this substance has the ISO common name flamprop [58667-63-3]. |
Structure: | |
Pronunciation: | flǎm-prǒp ěm Guide to British pronunciation |
InChIKey: | YQVMVCCFZCMYQB-SNVBAGLBSA-N |
InChI: | InChI=1S/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22)/t10-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names