| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alanine |
| CAS: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alanine |
| Reg. No.: | 90134-59-1 |
| Formula: | C16H13ClFNO3 |
| Activity: | herbicides (arylalanine herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example flamprop-M-isopropyl [63782-90-1], flamprop-M-methyl [63729-98-6]. The unresolved isomeric mixture of this substance has the ISO common name flamprop. |
| Structure: | ![]() |
| Pronunciation: | flǎm-prǒp ěm Guide to British pronunciation |
| InChI: | InChI=1/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22)/t10-/m1/s1/f/h21H |
A data sheet from the Compendium of Pesticide Common Names