| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alaninate |
| CAS: | methyl N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alaninate |
| Reg. No.: | 63729-98-6 |
| Formula: | C17H15ClFNO3 |
| Activity: | herbicides (arylalanine herbicides) |
| Notes: | This substance is a derivative of flamprop-M [90134-59-1]. The name “flamprop-M-méthyle” is used in France. The unresolved isomeric mixture of this substance has the ISO common name flamprop-methyl. |
| Structure: | ![]() |
| Pronunciation: | flǎm-prǒp ěm mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C17H15ClFNO3/c1-11(17(22)23-2)20(13-8-9-15(19)14(18)10-13)16(21)12-6-4-3-5-7-12/h3-11H,1-2H3/t11-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names