| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-DL-alanine |
| CAS: | N-benzoyl-N-(3-chloro-4-fluorophenyl)-DL-alanine |
| Reg. No.: | 58667-63-3 |
| Formula: | C16H13ClFNO3 |
| Activity: | herbicides (arylalanine herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example flamprop-isopropyl [52756-22-6], flamprop-methyl [52756-25-9]. The D-isomer of this substance has the ISO common name flamprop-M. |
| Structure: | ![]() |
| Pronunciation: | flǎm-prǒp Guide to British pronunciation |
| InChI: | InChI=1/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22)/t10-/s3/f/h21H |
A data sheet from the Compendium of Pesticide Common Names