| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | 3,6-dichloropyridine-2-carboxylic acid or 3,6-dichloropicolinic acid |
| CAS: | 3,6-dichloro-2-pyridinecarboxylic acid |
| Reg. No.: | 1702-17-6 |
| Formula: | C6H3Cl2NO2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example clopyralid-methyl [1532-24-7], clopyralid-olamine [57754-85-5], clopyralid-potassium [58509-83-4], clopyralid-tris(2-hydroxypropyl)ammonium. This compound is also included in Pesticides considered not to require common names (ISO 765-1976), as 3,6-dichloropicolinic acid. |
| Structure: | ![]() |
| InChI: | InChI=1/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11)/f/h10H |
A data sheet from the Compendium of Pesticide Common Names