Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,6-dichloropyridine-2-carboxylic acid |
IUPAC name: | 3,6-dichloropyridine-2-carboxylic acid pre-1969 name: 3,6-dichloropicolinic acid |
CAS name: | 3,6-dichloro-2-pyridinecarboxylic acid |
CAS Reg. No.: | 1702-17-6 |
Formula: | C6H3Cl2NO2 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example clopyralid-dimethylammonium [1096483-37-2], clopyralid-methyl [1532-24-7], clopyralid-olamine [57754-85-5], clopyralid-potassium [58509-83-4], clopyralid-tripromine [73455-09-1]. This compound was included in Pesticides considered not to require common names (ISO 765-1976), as 3,6-dichloropicolinic acid. |
Structure: | |
Pronunciation: | klō-pīr-a-lǐd Guide to British pronunciation |
InChIKey: | HUBANNPOLNYSAD-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H3Cl2NO2/c7-3-1-2-4(8)9-5(3)6(10)11/h1-2H,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names