Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,6-dichloropyridine-2-carboxylic acid—2-aminoethan-1-ol (1/1) |
IUPAC name: | 3,6-dichloropyridine-2-carboxylic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 3,6-dichloropyridine-2-carboxylate or 3,6-dichloropicolinic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 3,6-dichloropicolinate |
CAS name: | 3,6-dichloro-2-pyridinecarboxylic acid compound with 2-aminoethanol (1:1) |
CAS Reg. No.: | 57754-85-5 |
Formula: | C8H10Cl2N2O3 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | This substance is a derivative of clopyralid [1702-17-6]. |
Structure: | |
Pronunciation: | klō-pīr-a-lǐd ǒl-a-mēn Guide to British pronunciation |
InChIKey: | NQQBTWVFKDDVIB-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H3Cl2NO2.C2H7NO/c7-3-1-2-4(8)9-5(3)6(10)11;3-1-2-4/h1-2H,(H,10,11);4H,1-3H2 |
A data sheet from the Compendium of Pesticide Common Names