| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium 3,6-dichloropyridine-2-carboxylate or potassium 3,6-dichloropicolinate |
| CAS: | potassium 3,6-dichloro-2-pyridinecarboxylate |
| Reg. No.: | 58509-83-4 |
| Formula: | C6H2Cl2KNO2 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of clopyralid [1702-17-6]. |
| Structure: | ![]() |
| Pronunciation: | klō-pīr-a-lǐd pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C6H3Cl2NO2.K/c7-3-1-2-4(8)9-5(3)6(10)11;/h1-2H,(H,10,11);/q;+1/p-1/fC6H2Cl2NO2.K/q-1;m |
A data sheet from the Compendium of Pesticide Common Names