| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3,5-dibromo-4-hydroxybenzonitrile |
| CAS: | 3,5-dibromo-4-hydroxybenzonitrile |
| Reg. No.: | 1689-84-5 |
| Formula: | C7H3Br2NO |
| Activity: | herbicides (nitrile herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example bromoxynil butyrate [3861-41-4], bromoxynil heptanoate [56634-95-8], bromoxynil octanoate [1689-99-2], bromoxynil-potassium [2961-68-4]. |
| Structure: | ![]() |
| Pronunciation: | brō-mǒks-ǐ-nǐl Guide to British pronunciation |
| InChI: | InChI=1/C7H3Br2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
A data sheet from the Compendium of Pesticide Common Names