Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2,6-dibromo-4-cyanophenyl heptanoate |
IUPAC name: | 2,6-dibromo-4-cyanophenyl heptanoate |
CAS name: | 2,6-dibromo-4-cyanophenyl heptanoate |
CAS Reg. No.: | 56634-95-8 |
Formula: | C14H15Br2NO2 |
Activity: | herbicides (hydroxybenzonitrile) |
Notes: | This substance is a derivative of bromoxynil [1689-84-5]. |
Structure: | |
Pronunciation: | brō-mǒks-ǐ-nǐl hěp-tǎn-ō-āt Guide to British pronunciation |
InChIKey: | BHZWBQPHPLFZSV-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H15Br2NO2/c1-2-3-4-5-6-13(18)19-14-11(15)7-10(9-17)8-12(14)16/h7-8H,2-6H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names