Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium 2,6-dibromo-4-cyanophenolate |
IUPAC name: | potassium 2,6-dibromo-4-cyanophenolate |
CAS name: | 3,5-dibromo-4-hydroxybenzonitrile potassium salt |
CAS Reg. No.: | 2961-68-4 |
Formula: | C7H2Br2KNO |
Activity: | herbicides (hydroxybenzonitrile) |
Notes: | This substance is a derivative of bromoxynil [1689-84-5]. |
Structure: | |
Pronunciation: | brō-mǒks-ǐ-nǐl pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | HKSBGIRAPYUOPP-UHFFFAOYSA-M |
InChI: | InChI=1S/C7H3Br2NO.K/c8-5-1-4(3-10)2-6(9)7(5)11;/h1-2,11H;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names