| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-(2,4-dichlorophenoxy)butyric acid |
| CAS: | 4-(2,4-dichlorophenoxy)butanoic acid |
| Reg. No.: | 94-82-6 |
| Formula: | C10H10Cl2O3 |
| Activity: | herbicides (phenoxybutyric herbicides) plant growth regulators (auxins) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example 2,4-DB-butyl, 2,4-DB-dimethylammonium [2758-42-1], 2,4-DB-isoctyl [1320-15-6], 2,4-DB-potassium [19480-40-1], 2,4-DB-sodium [10433-59-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē bē Guide to British pronunciation |
| InChI: | InChI=1/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14)/f/h13H |
A data sheet from the Compendium of Pesticide Common Names