Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 4-(2,4-dichlorophenoxy)butanoic acid—N-methylmethanamine (1/1) |
IUPAC name: | 4-(2,4-dichlorophenoxy)butyric acid - dimethylamine (1:1) or dimethylammonium 4-(2,4-dichlorophenoxy)butyrate |
CAS name: | 4-(2,4-dichlorophenoxy)butanoic acid compound with N-methylmethanamine (1:1) |
CAS Reg. No.: | 2758-42-1 |
Formula: | C12H17Cl2NO3 |
Activity: | herbicides (phenoxybutyric) |
Notes: | This substance is a derivative of 2,4-DB [94-82-6]. |
Structure: | |
Pronunciation: | too for dē bē dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | KEIXJOCOXNOKHI-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names