| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | butyl 4-(2,4-dichlorophenoxy)butyrate |
| CAS: | butyl 4-(2,4-dichlorophenoxy)butanoate |
| Reg. No.: | |
| Formula: | C14H18Cl2O3 |
| Activity: | herbicides (phenoxybutyric herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-DB [94-82-6]. |
| Structure: | ![]() |
| Pronunciation: | too for dē bē bū-tīl Guide to British pronunciation |
| InChI: | InChI=1/C14H18Cl2O3/c1-2-3-8-19-14(17)5-4-9-18-13-7-6-11(15)10-12(13)16/h6-7,10H,2-5,8-9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names