| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | mixture of 80–100% 2-chloro-N-(6-ethyl-o-tolyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide and 20–0% 2-chloro-N-(6-ethyl-o-tolyl)-N-[(1R)-2-methoxy-1-methylethyl]acetamide or mixture of 80–100% (aRS,1S)-2-chloro-6′-ethyl-N-(2-methoxy-1-methylethyl)acet-o-toluidide and 20–0% (aRS,1R)-2-chloro-6′-ethyl-N-(2-methoxy-1-methylethyl)acet-o-toluidide |
| CAS: | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide |
| Reg. No.: | 87392-12-9 |
| Formula: | C15H22ClNO2 |
| Activity: | herbicides (chloroacetanilide herbicides) |
| Notes: | The unresolved substance has the ISO common name metolachlor. |
| Structure: | ![]() |
| InChI: | InChI=1/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names