Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(2R)-1-methoxypropan-2-yl]acetamide |
IUPAC name: | 2-chloro-2′-ethyl-N-[(1RS)-2-methoxy-1-methylethyl]-6′-methylacetanilide |
CAS name: | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)acetamide |
CAS Reg. No.: | 51218-45-2 |
Formula: | C15H22ClNO2 |
Activity: | herbicides (chloroacetamide) |
Notes: | The (S)-stereoisomer of this substance has the ISO common name S-metolachlor. |
Structure: | |
Pronunciation: | mě-tǒl-a-klor Guide to British pronunciation |
InChIKey: | WVQBLGZPHOPPFO-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names