| Status: | ISO 765 |
|---|---|
| IUPAC: | pentachlorophenol |
| CAS: | 2,3,4,5,6-pentachlorophenol |
| Reg. No.: | 87-86-5 |
| Formula: | C6HCl5O |
| Activity: | fungicides (aromatic fungicides) herbicides (unclassified herbicides) insecticides (organochlorine insecticides) molluscicides plant growth regulators (defoliants) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “PCP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries and the Weed Science Society of America, and is also approved in China (五氯酚). The sodium salt is also considered by the International Organization for Standardization not to require a common name, see sodium pentachlorophenoxide [131-52-2]. The methylmercury derivative is considered by the British Standards Institution not to require a common name, see methylmercury pentachlorophenoxide. |
| Structure: |  |
| Pronunciation: | pěn-ta-klor-ō-fē-nǒl Guide to British pronunciation |
| InChIKey: | IZUPBVBPLAPZRR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6HCl5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |