| Status: | BS 1831c |
|---|---|
| IUPAC: | methylmercury(II) pentachlorophenolate or methylmercury(II) pentachlorophenoxide or methylmercury(2+) pentachlorophenolate or methylmercury(2+) pentachlorophenoxide or methylmercuric pentachlorophenolate or methylmercuric pentachlorophenoxide |
| CAS: | methyl(pentachlorophenolato-κO)mercury |
| Reg. No.: | |
| Formula: | C7H3Cl5HgO |
| Activity: | fungicides (organomercury fungicides) |
| Notes: | This substance is considered by the British Standards Institution not to require a common name. The parent alcohol is considered by the Internatonal Organization for Standardization not to require a common name, see pentachlorophenol. |
| Structure: |  |
| Pronunciation: | mē-thīl-mer-kūr-ē pěn-ta-klor-ō-fěn-ǒk-sīd Guide to British pronunciation |
| InChI: | InChI=1/C6HCl5O.CH3.Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;1H3;/q;;+1/p-1/fC6Cl5O.CH3.Hg/h12h;;/q-1;;m/rC7H3Cl5HgO/c1-13-14-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |