| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2′,5-dichloro-4′-nitrosalicylanilide |
| CAS: | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Reg. No.: | 50-65-7 |
| Formula: | C13H8Cl2N2O4 |
| Activity: | molluscicides |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example niclosamide-olamine [1420-04-8]. The name “clonitralid” is used in Germany. |
| Structure: | ![]() |
| Pronunciation: | nǐ-klōs-a-mīd Guide to British pronunciation |
| InChIKey: | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
A data sheet from the Compendium of Pesticide Common Names