Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide—2-aminoethan-1-ol (1/1) |
IUPAC name: | 2′,5-dichloro-4′-nitrosalicylanilide - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 4-chloro-2-[(2-chloro-4-nitroanilino)carbonyl]phenolate |
CAS name: | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide compound with 2-aminoethanol (1:1) |
CAS Reg. No.: | 1420-04-8 |
Formula: | C15H15Cl2N3O5 |
Activity: | molluscicides |
Notes: | This substance is a derivative of niclosamide [50-65-7]. |
Structure: | |
Pronunciation: | nǐ-klōs-a-mīd ǒl-a-mēn Guide to British pronunciation |
InChIKey: | XYCDHXSQODHSLG-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H8Cl2N2O4.C2H7NO/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15;3-1-2-4/h1-6,18H,(H,16,19);4H,1-3H2 |
A data sheet from the Compendium of Pesticide Common Names