Status: | ISO 1750 (published) |
---|---|
IUPAC name: | methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate 1979 Rules: methyl N-(methoxyacetyl)-N-2,6-xylyl-DL-alaninate |
CAS name: | methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate |
CAS Reg. No.: | 57837-19-1 |
Formula: | C15H21NO4 |
Activity: | fungicides (acylalanine) |
Notes: | The (−)-enantiomer of this substance has the ISO common name metalaxyl-M [70630-17-0]. |
Structure: | |
Pronunciation: | mět-a-lǎks-ǐl Guide to British pronunciation |
InChIKey: | ZQEIXNIJLIKNTD-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names