| Status: | ISO 1750 (approved) |
|---|---|
| IUPAC: | methyl N-(methoxyacetyl)-N-(2,6-xylyl)-D-alaninate |
| CAS: | methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-D-alaninate |
| Reg. No.: | 70630-17-0 |
| Formula: | C15H21NO4 |
| Activity: | fungicides (acylamino acid fungicides; anilide fungicides) |
| Notes: | The unresolved isomeric mixture of this substance has the ISO common name metalaxyl. The name “mefenoxam” has been used in the literature but has no official status. |
| Structure: |  |
| InChI: | InChI=1/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m1/s1 |