| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinic acid |
| CAS: | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridinecarboxylic acid |
| Reg. No.: | 81334-34-1 |
| Formula: | C13H15N3O3 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example imazapyr-isopropylammonium [81510-83-0]. |
| Structure: | ![]() |
| Pronunciation: | ǐm-āz-a-pīr Guide to British pronunciation |
| InChI: | InChI=1/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19)/f/h15,17H |
A data sheet from the Compendium of Pesticide Common Names