| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinic acid - isopropylamine (1:1) or isopropylammonium 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinate |
| CAS: | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridinecarboxylic acid compound with 2-propanamine (1:1) |
| Reg. No.: | 81510-83-0 |
| Formula: | C16H24N4O3 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | This substance is a derivative of imazapyr [81334-34-1]. The name “咪唑烟酸” is approved in China for imazapyr and for imazapyr-isopropylammonium. |
| Structure: | ![]() |
| Pronunciation: | ǐm-āz-a-pīr ī-sō-prō-pīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | KCTKQZUYHSKJLP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H15N3O3.C3H9N/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9;1-3(2)4/h4-7H,1-3H3,(H,17,18)(H,15,16,19);3H,4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names