Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetic acid |
IUPAC name: | [(4-amino-3,5-dichloro-6-fluoro-2-pyridyl)oxy]acetic acid |
CAS name: | 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid |
CAS Reg. No.: | 69377-81-7 |
Formula: | C7H5Cl2FN2O3 |
Activity: | herbicides (pyridyloxycarboxylic acid) |
Notes: | * The name “fluroxypyr” (n.m.) is also used in francophone countries. When this substance is used as an ester or a salt, its identity should be stated, for example fluroxypyr-butometyl [154486-27-8], fluroxypyr-meptyl [81406-37-3]. |
Structure: | |
Pronunciation: | flūr-ǒks-ē-pīr Guide to British pronunciation |
InChIKey: | MEFQWPUMEMWTJP-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names