| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid |
| CAS: | 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid |
| Reg. No.: | 69377-81-7 |
| Formula: | C7H5Cl2FN2O3 |
| Activity: | herbicides (pyridine herbicides) |
| Notes: | * The name “fluroxypyr” (n.m.) is also used in francophone countries. When this substance is used as an ester or a salt, its identity should be stated, for example fluroxypyr-butometyl [154486-27-8], fluroxypyr-meptyl [81406-37-3]. |
| Structure: | ![]() |
| Pronunciation: | flūr-ǒks-ē-pīr Guide to British pronunciation |
| InChIKey: | MEFQWPUMEMWTJP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14) |
A data sheet from the Compendium of Pesticide Common Names