Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-1-butoxypropan-2-yl [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate |
IUPAC name: | (RS)-2-butoxy-1-methylethyl [(4-amino-3,5-dichloro-6-fluoro-2-pyridyl)oxy]acetate |
CAS name: | 2-butoxy-1-methylethyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
CAS Reg. No.: | 154486-27-8 |
Formula: | C14H19Cl2FN2O4 |
Activity: | herbicides (pyridyloxycarboxylic acid) |
Notes: | This substance is a derivative of fluroxypyr [69377-81-7]. The name “fluoroxypyr-butométyl” is used in France. |
Structure: | |
Pronunciation: | flūr-ǒks-ē-pīr bū-tō-mē-tīl Guide to British pronunciation |
InChIKey: | ZKFARSBUEBZZJT-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H19Cl2FN2O4/c1-3-4-5-21-6-8(2)23-9(20)7-22-14-11(16)12(18)10(15)13(17)19-14/h8H,3-7H2,1-2H3,(H2,18,19) |
A data sheet from the Compendium of Pesticide Common Names