| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-butoxy-1-methylethyl 4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetate |
| CAS: | 2-butoxy-1-methylethyl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| Reg. No.: | 154486-27-8 |
| Formula: | C14H19Cl2FN2O4 |
| Activity: | herbicides (pyridine herbicides) |
| Notes: | This substance is a derivative of fluroxypyr [69377-81-7]. The name “fluoroxypyr-butometyl” is used in France. |
| Structure: | ![]() |
| Pronunciation: | flūr-ǒks-ē-pīr bū-tō-mē-tīl Guide to British pronunciation |
| InChIKey: | ZKFARSBUEBZZJT-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H19Cl2FN2O4/c1-3-4-5-21-6-8(2)23-9(20)7-22-14-11(16)12(18)10(15)13(17)19-14/h8H,3-7H2,1-2H3,(H2,18,19) |
A data sheet from the Compendium of Pesticide Common Names