| Status: |
ISO 1750 (published) |
| IUPAC: |
1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxopyridazine-3-carboxylic acid |
| CAS: |
1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-3-pyridazinecarboxylic acid |
| Reg. No.: |
68254-10-4 |
| Formula: |
C12H9ClN2O3 |
| Activity: |
plant growth regulators (unclassified plant growth regulators) |
| Notes: |
When this substance is used as an ester or a salt, its identity should be stated, for example fenridazon-potassium [83588-43-6]. |
| Structure: |
 |
| Pronunciation: |
fěn-rǐd-a-zǒn Guide to British pronunciation |
| InChI: |
InChI=1/C12H9ClN2O3/c1-7-6-10(16)11(12(17)18)14-15(7)9-4-2-8(13)3-5-9/h2-6H,1H3,(H,17,18)/f/h17H |