Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | potassium 1-(4-chlorophenyl)-6-methyl-4-oxo-1,4-dihydropyridazine-3-carboxylate |
IUPAC name: | potassium 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxopyridazine-3-carboxylate |
CAS name: | potassium 1-(4-chlorophenyl)-1,4-dihydro-6-methyl-4-oxo-3-pyridazinecarboxylate |
CAS Reg. No.: | 83588-43-6 |
Formula: | C12H8ClKN2O3 |
Activity: | plant growth regulators (gametocide) |
Notes: | This substance is a derivative of fenridazon [68254-10-4]. |
Structure: | |
Pronunciation: | fěn-rǐd-a-zǒn pa-tǎs-ē-am Guide to British pronunciation |
InChIKey: | JERZDNVZTNNBNO-UHFFFAOYSA-M |
InChI: | InChI=1S/C12H9ClN2O3.K/c1-7-6-10(16)11(12(17)18)14-15(7)9-4-2-8(13)3-5-9;/h2-6H,1H3,(H,17,18);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names