| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (R)-2-(2,4-dichlorophenoxy)propionic acid |
| CAS: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
| Reg. No.: | 15165-67-0 |
| Formula: | C9H8Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example dichlorprop-P-dimethylammonium [104786-87-0]. The unresolved isomeric mixture of this substance has the common name dichlorprop. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp pē Guide to British pronunciation |
| InChIKey: | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| InChI: | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names