| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid - dimethylamine (1:1) or dimethylammonium (2R)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | (2R)-2-(2,4-dichlorophenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 104786-87-0 |
| Formula: | C11H15Cl2NO3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop-P [15165-67-0]. The unresolved isomeric mixture of this substance has the ISO common name dichlorprop-dimethylammonium. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp pē dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | WRXSEWUFHVTFEX-NUBCRITNSA-N |
| InChI: | InChI=1S/C9H8Cl2O3.C2H7N/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;1-3-2/h2-5H,1H3,(H,12,13);3H,1-2H3/t5-;/m1./s1 |
A data sheet from the Compendium of Pesticide Common Names