Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | oxalic acid—N,N-dimethyl-1,2,3-trithian-5-amine (1/1) |
IUPAC name: | dimethyl(1,2,3-trithian-5-yl)amine—oxalic acid (1/1) 1979 Rules: N,N-dimethyl-1,2,3-trithian-5-ylamine—oxalic acid (1/1) |
CAS name: | N,N-dimethyl-1,2,3-trithian-5-amine ethanedioate (1:1) |
CAS Reg. No.: | 31895-22-4 |
Formula: | C7H13NO4S3 |
Activity: | insecticides (nereistoxin analogue) |
Notes: | This substance is a derivative of thiocyclam [31895-21-3]. |
Structure: | |
Pronunciation: | thī-ō-sī-klǎm ǒks-a-lāt Guide to British pronunciation |
InChIKey: | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) |
A data sheet from the Compendium of Pesticide Common Names