| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | N,N-dimethyl-1,2,3-trithian-5-ylamine |
| CAS: | N,N-dimethyl-1,2,3-trithian-5-amine |
| Reg. No.: | 31895-21-3 |
| Formula: | C5H11NS3 |
| Activity: | insecticides (nereistoxin analogue insecticides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example thiocyclam oxalate [31895-22-4]. |
| Structure: | ![]() |
| Pronunciation: | thī-ō-sī-klǎm Guide to British pronunciation |
| InChI: | InChI=1/C5H11NS3/c1-6(2)5-3-7-9-8-4-5/h5H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names