Status: | modified ISO 1750 (published) |
---|---|
IUPAC name: | N,N-dimethyl-1,2,3-trithian-5-ylamine hydrochloride |
CAS name: | N,N-dimethyl-1,2,3-trithian-5-amine hydrochloride (1:1) |
CAS Reg. No.: | 75655-75-3 |
Formula: | C5H12ClNS3 |
Activity: | insecticides (nereistoxin analogue) |
Notes: | This substance is a derivative of thiocyclam [31895-21-3]. The name “trithialan” (杀虫钉) is approved in China. |
Structure: | |
Pronunciation: | thī-ō-sī-klǎm hī-drō-klor-ǐd Guide to British pronunciation |
InChIKey: | DYLDNPYVDMQCFR-UHFFFAOYSA-N |
InChI: | InChI=1S/C5H11NS3.ClH/c1-6(2)5-3-7-9-8-4-5;/h5H,3-4H2,1-2H3;1H |
A data sheet from the Compendium of Pesticide Common Names