Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 1,1-dimethylpiperidin-1-ium chloride |
IUPAC name: | 1,1-dimethylpiperidinium chloride |
CAS name: | 1,1-dimethylpiperidinium chloride |
CAS Reg. No.: | 24307-26-4 |
Formula: | C7H16ClN |
Activity: | plant growth regulators (growth inhibitor) |
Notes: | This substance is a derivative of mepiquat [15302-91-7]. The Chinese name “缩节胺” has also been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | mě-pǐ-kwǒt klor-īd Guide to British pronunciation |
InChIKey: | VHOVSQVSAAQANU-UHFFFAOYSA-M |
InChI: | InChI=1S/C7H16N.ClH/c1-8(2)6-4-3-5-7-8;/h3-7H2,1-2H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names