| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 1,1-dimethylpiperidinium |
| CAS: | 1,1-dimethylpiperidinium |
| Reg. No.: | 15302-91-7 |
| Formula: | C7H16N |
| Activity: | plant growth regulators (growth inhibitors) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example mepiquat chloride [24307-26-4], mepiquat pentaborate [245735-90-4]. |
| Structure: | ![]() |
| Pronunciation: | mě-pǐ-kwǒt Guide to British pronunciation |
| InChIKey: | NNCAWEWCFVZOGF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
A data sheet from the Compendium of Pesticide Common Names