| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (R)-2-(4-chloro-o-tolyloxy)propionic acid - dimethylamine (1:1) or dimethylammonium (R)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | (2R)-2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 66423-09-4 |
| Formula: | C12H18ClNO3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop-P [16484-77-8]. The unresolved isomeric mixture of this substance has the ISO common name mecoprop-dimethylammonium [32351-70-5]. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp pē dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | ROGDGDPDLIVQFZ-OGFXRTJISA-N |
| InChI: | InChI=1S/C10H11ClO3.C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h3-5,7H,1-2H3,(H,12,13);3H,1-2H3/t7-;/m1./s1 |