| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-(4-chloro-o-tolyloxy)propionic acid - dimethylamine (1:1) or dimethylammonium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| CAS: | 2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 32351-70-5 |
| Formula: | C12H18ClNO3 |
| Activity: | herbicides (phenoxypropionic herbicides) |
| Notes: | This substance is a derivative of mecoprop [7085-19-0]. The name “MCPP-dimethylammonium” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. The (R)-isomer of this substance has the ISO common name mecoprop-P-dimethylammonium. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C10H11ClO3.C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h3-5,7H,1-2H3,(H,12,13);3H,1-2H3/f/h12H; |