| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 4-chloro-o-tolyloxyacetate |
| CAS: | sodium (4-chloro-2-methylphenoxy)acetate |
| Reg. No.: | 3653-48-3 |
| Formula: | C9H8ClNaO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-sodium” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā sō-dē-am Guide to British pronunciation |
| InChI: | InChI=1/C9H9ClO3.Na/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;/h2-4H,5H2,1H3,(H,11,12);/q;+1/p-1/fC9H8ClO3.Na/q-1;m |
A data sheet from the Compendium of Pesticide Common Names