| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chloro-o-tolyloxyacetic acid |
| CAS: | (4-chloro-2-methylphenoxy)acetic acid |
| Reg. No.: | 94-74-6 |
| Formula: | C9H9ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example MCPA-butotyl [19480-43-4], MCPA-butyl [1713-12-8], MCPA-dimethylammonium [2039-46-5], MCPA-diolamine [20405-19-0], MCPA-ethyl [2698-38-6], MCPA-2-ethylhexyl [29450-45-1], MCPA-isobutyl [1713-11-7], MCPA-isoctyl [26544-20-7], MCPA-isopropyl [2698-40-0], MCPA-methyl [2436-73-9], MCPA-olamine [6365-62-4], MCPA-potassium [5221-16-9], MCPA-sodium [3653-48-3], MCPA-trolamine [42459-68-7]. The name “metaxon” (метаксон) was used in the former USSR. |
| Structure: |  |
| InChI: | InChI=1/C9H9ClO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)/f/h11H |