| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | butyl 4-chloro-o-tolyloxyacetate |
| CAS: | butyl (4-chloro-2-methylphenoxy)acetate |
| Reg. No.: | 1713-12-8 |
| Formula: | C13H17ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-butyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā bū-tīl Guide to British pronunciation |
| InChI: | InChI=1/C13H17ClO3/c1-3-4-7-16-13(15)9-17-12-6-5-11(14)8-10(12)2/h5-6,8H,3-4,7,9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names