| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-chlorofluorene-9-carboxylic acid |
| CAS: | 2-chloro-9H-fluorene-9-carboxylic acid |
| Reg. No.: | 24539-66-0 |
| Formula: | C14H9ClO2 |
| Activity: | plant growth regulators (morphactins) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example chlorfluren-methyl [22909-50-8]. |
| Structure: | ![]() |
| Pronunciation: | klor-flūr-ěn Guide to British pronunciation |
| InChIKey: | GJGFCWCPVQHXMF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H9ClO2/c15-8-5-6-10-9-3-1-2-4-11(9)13(14(16)17)12(10)7-8/h1-7,13H,(H,16,17) |
A data sheet from the Compendium of Pesticide Common Names