Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-methyl (9R)-2-chloro-9H-fluorene-9-carboxylate |
IUPAC name: | methyl (RS)-2-chlorofluorene-9-carboxylate |
CAS name: | methyl 2-chloro-9H-fluorene-9-carboxylate |
CAS Reg. No.: | 22909-50-8 |
Formula: | C15H11ClO2 |
Activity: | plant growth regulators (morphactin) |
Notes: | This substance is a derivative of chlorfluren [24539-66-0]. |
Structure: | |
Pronunciation: | klor-flūr-ěn mē-thīl Guide to British pronunciation |
InChIKey: | DFYPVJHFCVSDEV-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H11ClO2/c1-18-15(17)14-12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)14/h2-8,14H,1H3 |
A data sheet from the Compendium of Pesticide Common Names